C11H13NO2 — CID 84663192
3-(2,3-dihydro-1-benzofuran-7-yloxy)azetidine (PubChem CID 84663192) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 3-(2,3-dihydro-1-benzofuran-7-yloxy)azetidine.
| Compound Name | 3-(2,3-dihydro-1-benzofuran-7-yloxy)azetidine |
|---|---|
| PubChem CID | 84663192 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 3-(2,3-dihydro-1-benzofuran-7-yloxy)azetidine |
| SMILES | c1cc2c(c(OC3CNC3)c1)OCC2 |
| InChI | InChI=1S/C11H13NO2/c1-2-8-4-5-13-11(8)10(3-1)14-9-6-12-7-9/h1-3,9,12H,4-7H2 |
| InChIKey | OVDWVUAEGKTVAD-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |