C16H20N2O — CID 165409090
3-(3,4-dihydro-2H-chromen-8-yl)-2-methylpyridine;methanamine (PubChem CID 165409090) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-chromen-8-yl)-2-methylpyridine;methanamine.
| Compound Name | 3-(3,4-dihydro-2H-chromen-8-yl)-2-methylpyridine;methanamine |
|---|---|
| PubChem CID | 165409090 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 3-(3,4-dihydro-2H-chromen-8-yl)-2-methylpyridine;methanamine |
| SMILES | CN.Cc1ncccc1-c1cccc2c1OCCC2 |
| InChI | InChI=1S/C15H15NO.CH5N/c1-11-13(8-3-9-16-11)14-7-2-5-12-6-4-10-17-15(12)14;1-2/h2-3,5,7-9H,4,6,10H2,1H3;2H2,1H3 |
| InChIKey | RGJVLPGZWBZRPP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |