About 4-(3,4-dihydro-2H-chromen-8-yl)pyridine
4-(3,4-dihydro-2H-chromen-8-yl)pyridine (PubChem CID 165409197) has the molecular formula C14H13NO
and a molecular weight of 211.26 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-chromen-8-yl)pyridine.
Molecular Properties
| Compound Name | 4-(3,4-dihydro-2H-chromen-8-yl)pyridine |
| PubChem CID | 165409197 |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 4-(3,4-dihydro-2H-chromen-8-yl)pyridine |
| SMILES | c1cc2c(c(-c3ccncc3)c1)OCCC2 |
| InChI | InChI=1S/C14H13NO/c1-3-12-4-2-10-16-14(12)13(5-1)11-6-8-15-9-7-11/h1,3,5-9H,2,4,10H2 |
| InChIKey | PVRNWTOGZIFKFS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(3,4-dihydro-2H-chromen-8-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dihydro-2H-chromen-8-yl)pyridine?
The IUPAC name of 4-(3,4-dihydro-2H-chromen-8-yl)pyridine (CID 165409197) is 4-(3,4-dihydro-2H-chromen-8-yl)pyridine.
What is the SMILES notation for 4-(3,4-dihydro-2H-chromen-8-yl)pyridine?
The canonical SMILES for 4-(3,4-dihydro-2H-chromen-8-yl)pyridine is c1cc2c(c(-c3ccncc3)c1)OCCC2.
What is the InChIKey of 4-(3,4-dihydro-2H-chromen-8-yl)pyridine?
The InChIKey is PVRNWTOGZIFKFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO/c1-3-12-4-2-10-16-14(12)13(5-1)11-6-8-15-9-7-11/h1,3,5-9H,2,4,10H2.
What are the key properties of 4-(3,4-dihydro-2H-chromen-8-yl)pyridine?
4-(3,4-dihydro-2H-chromen-8-yl)pyridine has a molecular weight of 211.26 g/mol, XLogP of 3.07, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dihydro-2H-chromen-8-yl)pyridine is sourced from PubChem (CID 165409197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).