C14H14N2O — CID 68578553
9-pyridin-4-yl-2,3,4,5-tetrahydro-1,4-benzoxazepine (PubChem CID 68578553) has the molecular formula C14H14N2O and a molecular weight of 226.28 g/mol. Its IUPAC name is 9-pyridin-4-yl-2,3,4,5-tetrahydro-1,4-benzoxazepine.
| Compound Name | 9-pyridin-4-yl-2,3,4,5-tetrahydro-1,4-benzoxazepine |
|---|---|
| PubChem CID | 68578553 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 9-pyridin-4-yl-2,3,4,5-tetrahydro-1,4-benzoxazepine |
| SMILES | c1cc2c(c(-c3ccncc3)c1)OCCNC2 |
| InChI | InChI=1S/C14H14N2O/c1-2-12-10-16-8-9-17-14(12)13(3-1)11-4-6-15-7-5-11/h1-7,16H,8-10H2 |
| InChIKey | RKBWHWXKYZRDBW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |