C15H14FNO — CID 68580169
9-(3-fluorophenyl)-2,3,4,5-tetrahydro-1,4-benzoxazepine (PubChem CID 68580169) has the molecular formula C15H14FNO and a molecular weight of 243.28 g/mol. Its IUPAC name is 9-(3-fluorophenyl)-2,3,4,5-tetrahydro-1,4-benzoxazepine.
| Compound Name | 9-(3-fluorophenyl)-2,3,4,5-tetrahydro-1,4-benzoxazepine |
|---|---|
| PubChem CID | 68580169 |
| Molecular Formula | C15H14FNO |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 9-(3-fluorophenyl)-2,3,4,5-tetrahydro-1,4-benzoxazepine |
| SMILES | Fc1cccc(-c2cccc3c2OCCNC3)c1 |
| InChI | InChI=1S/C15H14FNO/c16-13-5-1-3-11(9-13)14-6-2-4-12-10-17-7-8-18-15(12)14/h1-6,9,17H,7-8,10H2 |
| InChIKey | SKXDOWGJKNRBPG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |