C13H17NO2 — CID 25012376
9-(oxolan-3-yl)-2,3,4,5-tetrahydro-1,4-benzoxazepine (PubChem CID 25012376) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 9-(oxolan-3-yl)-2,3,4,5-tetrahydro-1,4-benzoxazepine.
| Compound Name | 9-(oxolan-3-yl)-2,3,4,5-tetrahydro-1,4-benzoxazepine |
|---|---|
| PubChem CID | 25012376 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 9-(oxolan-3-yl)-2,3,4,5-tetrahydro-1,4-benzoxazepine |
| SMILES | c1cc2c(c(C3CCOC3)c1)OCCNC2 |
| InChI | InChI=1S/C13H17NO2/c1-2-10-8-14-5-7-16-13(10)12(3-1)11-4-6-15-9-11/h1-3,11,14H,4-9H2 |
| InChIKey | ISPNXPJQCLRPER-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |