C14H13NO2 — CID 114747681
6-(3,4-dihydro-2H-chromen-8-yl)pyridin-3-ol (PubChem CID 114747681) has the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. Its IUPAC name is 6-(3,4-dihydro-2H-chromen-8-yl)pyridin-3-ol.
| Compound Name | 6-(3,4-dihydro-2H-chromen-8-yl)pyridin-3-ol |
|---|---|
| PubChem CID | 114747681 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 6-(3,4-dihydro-2H-chromen-8-yl)pyridin-3-ol |
| SMILES | Oc1ccc(-c2cccc3c2OCCC3)nc1 |
| InChI | InChI=1S/C14H13NO2/c16-11-6-7-13(15-9-11)12-5-1-3-10-4-2-8-17-14(10)12/h1,3,5-7,9,16H,2,4,8H2 |
| InChIKey | BJEQPGMDECCSLQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |