C9H10OS — CID 123990330
3,4-dihydro-2H-chromene-8-thiol (PubChem CID 123990330) has the molecular formula C9H10OS and a molecular weight of 166.25 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromene-8-thiol.
| Compound Name | 3,4-dihydro-2H-chromene-8-thiol |
|---|---|
| PubChem CID | 123990330 |
| Molecular Formula | C9H10OS |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 3,4-dihydro-2H-chromene-8-thiol |
| SMILES | Sc1cccc2c1OCCC2 |
| InChI | InChI=1S/C9H10OS/c11-8-5-1-3-7-4-2-6-10-9(7)8/h1,3,5,11H,2,4,6H2 |
| InChIKey | YLQUHXHFBSFIOQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|