C9H11ClO4S — CID 174945642
3,4-dihydro-2H-chromene-8-sulfonic acid;hydrochloride (PubChem CID 174945642) has the molecular formula C9H11ClO4S and a molecular weight of 250.70 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromene-8-sulfonic acid;hydrochloride.
| Compound Name | 3,4-dihydro-2H-chromene-8-sulfonic acid;hydrochloride |
|---|---|
| PubChem CID | 174945642 |
| Molecular Formula | C9H11ClO4S |
| Molecular Weight | 250.70 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 3,4-dihydro-2H-chromene-8-sulfonic acid;hydrochloride |
| SMILES | Cl.O=S(=O)(O)c1cccc2c1OCCC2 |
| InChI | InChI=1S/C9H10O4S.ClH/c10-14(11,12)8-5-1-3-7-4-2-6-13-9(7)8;/h1,3,5H,2,4,6H2,(H,10,11,12);1H |
| InChIKey | ZWRVFWXHHPMWLX-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.70 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|