C15H22N2O4S — CID 122490834
(2S)-2-amino-N-(3,4-dihydro-2H-chromen-8-ylsulfonyl)-4-methylpentanamide (PubChem CID 122490834) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is (2S)-2-amino-N-(3,4-dihydro-2H-chromen-8-ylsulfonyl)-4-methylpentanamide.
| Compound Name | (2S)-2-amino-N-(3,4-dihydro-2H-chromen-8-ylsulfonyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 122490834 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | (2S)-2-amino-N-(3,4-dihydro-2H-chromen-8-ylsulfonyl)-4-methylpentanamide |
| SMILES | CC(C)C[C@H](N)C(=O)NS(=O)(=O)c1cccc2c1OCCC2 |
| InChI | InChI=1S/C15H22N2O4S/c1-10(2)9-12(16)15(18)17-22(19,20)13-7-3-5-11-6-4-8-21-14(11)13/h3,5,7,10,12H,4,6,8-9,16H2,1-2H3,(H,17,18)/t12-/m0/s1 |
| InChIKey | XSNBAOJPGNRACU-LBPRGKRZSA-N |
| XLogP | 1.19 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |