C14H17N5O — CID 114747343
6-(3,4-dihydro-2H-chromen-8-yl)-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 114747343) has the molecular formula C14H17N5O and a molecular weight of 271.32 g/mol. Its IUPAC name is 6-(3,4-dihydro-2H-chromen-8-yl)-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(3,4-dihydro-2H-chromen-8-yl)-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 114747343 |
| Molecular Formula | C14H17N5O |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 6-(3,4-dihydro-2H-chromen-8-yl)-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CN(C)c1nc(N)nc(-c2cccc3c2OCCC3)n1 |
| InChI | InChI=1S/C14H17N5O/c1-19(2)14-17-12(16-13(15)18-14)10-7-3-5-9-6-4-8-20-11(9)10/h3,5,7H,4,6,8H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | YMGXADHJKUKFMB-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |