C16H18FNO — CID 143567573
8-(2-fluorophenyl)-3,4-dihydro-2H-chromene;methanamine (PubChem CID 143567573) has the molecular formula C16H18FNO and a molecular weight of 259.32 g/mol. Its IUPAC name is 8-(2-fluorophenyl)-3,4-dihydro-2H-chromene;methanamine.
| Compound Name | 8-(2-fluorophenyl)-3,4-dihydro-2H-chromene;methanamine |
|---|---|
| PubChem CID | 143567573 |
| Molecular Formula | C16H18FNO |
| Molecular Weight | 259.32 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 8-(2-fluorophenyl)-3,4-dihydro-2H-chromene;methanamine |
| SMILES | CN.Fc1ccccc1-c1cccc2c1OCCC2 |
| InChI | InChI=1S/C15H13FO.CH5N/c16-14-9-2-1-7-12(14)13-8-3-5-11-6-4-10-17-15(11)13;1-2/h1-3,5,7-9H,4,6,10H2;2H2,1H3 |
| InChIKey | SLVAIDFEXUJFNF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |