C15H14FNO — CID 114746463
3-(3,4-dihydro-2H-chromen-8-yl)-4-fluoroaniline (PubChem CID 114746463) has the molecular formula C15H14FNO and a molecular weight of 243.28 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-chromen-8-yl)-4-fluoroaniline.
| Compound Name | 3-(3,4-dihydro-2H-chromen-8-yl)-4-fluoroaniline |
|---|---|
| PubChem CID | 114746463 |
| Molecular Formula | C15H14FNO |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 3-(3,4-dihydro-2H-chromen-8-yl)-4-fluoroaniline |
| SMILES | Nc1ccc(F)c(-c2cccc3c2OCCC3)c1 |
| InChI | InChI=1S/C15H14FNO/c16-14-7-6-11(17)9-13(14)12-5-1-3-10-4-2-8-18-15(10)12/h1,3,5-7,9H,2,4,8,17H2 |
| InChIKey | QEOLRWCXQVTZLD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|