C17H15FO2 — CID 114746501
1-[3-(3,4-dihydro-2H-chromen-8-yl)-4-fluorophenyl]ethanone (PubChem CID 114746501) has the molecular formula C17H15FO2 and a molecular weight of 270.30 g/mol. Its IUPAC name is 1-[3-(3,4-dihydro-2H-chromen-8-yl)-4-fluorophenyl]ethanone.
| Compound Name | 1-[3-(3,4-dihydro-2H-chromen-8-yl)-4-fluorophenyl]ethanone |
|---|---|
| PubChem CID | 114746501 |
| Molecular Formula | C17H15FO2 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 1-[3-(3,4-dihydro-2H-chromen-8-yl)-4-fluorophenyl]ethanone |
| SMILES | CC(=O)c1ccc(F)c(-c2cccc3c2OCCC3)c1 |
| InChI | InChI=1S/C17H15FO2/c1-11(19)13-7-8-16(18)15(10-13)14-6-2-4-12-5-3-9-20-17(12)14/h2,4,6-8,10H,3,5,9H2,1H3 |
| InChIKey | LWEZMNCQBGMOLF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |