C13H16O2 — CID 114744106
1-(2,3-dihydro-1-benzofuran-7-yl)-2-methylbutan-1-one (PubChem CID 114744106) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-7-yl)-2-methylbutan-1-one.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-7-yl)-2-methylbutan-1-one |
|---|---|
| PubChem CID | 114744106 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-7-yl)-2-methylbutan-1-one |
| SMILES | CCC(C)C(=O)c1cccc2c1OCC2 |
| InChI | InChI=1S/C13H16O2/c1-3-9(2)12(14)11-6-4-5-10-7-8-15-13(10)11/h4-6,9H,3,7-8H2,1-2H3 |
| InChIKey | GCQNEINOUSBFTF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |