C12H12O2 — CID 103453398
(E)-1-(2,3-dihydro-1-benzofuran-7-yl)but-2-en-1-one (PubChem CID 103453398) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is (E)-1-(2,3-dihydro-1-benzofuran-7-yl)but-2-en-1-one.
| Compound Name | (E)-1-(2,3-dihydro-1-benzofuran-7-yl)but-2-en-1-one |
|---|---|
| PubChem CID | 103453398 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | (E)-1-(2,3-dihydro-1-benzofuran-7-yl)but-2-en-1-one |
| SMILES | C/C=C/C(=O)c1cccc2c1OCC2 |
| InChI | InChI=1S/C12H12O2/c1-2-4-11(13)10-6-3-5-9-7-8-14-12(9)10/h2-6H,7-8H2,1H3/b4-2+ |
| InChIKey | OWLXGOHXBZXFRA-DUXPYHPUSA-N |
| XLogP | 2.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|