C20H31NO2 — CID 70486415
(2S)-2-undecyl-2,3-dihydro-1H-indole-4-carboxylic acid (PubChem CID 70486415) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is (2S)-2-undecyl-2,3-dihydro-1H-indole-4-carboxylic acid.
| Compound Name | (2S)-2-undecyl-2,3-dihydro-1H-indole-4-carboxylic acid |
|---|---|
| PubChem CID | 70486415 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | (2S)-2-undecyl-2,3-dihydro-1H-indole-4-carboxylic acid |
| SMILES | CCCCCCCCCCC[C@H]1Cc2c(cccc2C(=O)O)N1 |
| InChI | InChI=1S/C20H31NO2/c1-2-3-4-5-6-7-8-9-10-12-16-15-18-17(20(22)23)13-11-14-19(18)21-16/h11,13-14,16,21H,2-10,12,15H2,1H3,(H,22,23)/t16-/m0/s1 |
| InChIKey | QEHLGMFFAPMLGI-INIZCTEOSA-N |
| XLogP | 5.64 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|