C20H27NO2 — CID 175872630
7-hexyl-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-4-carboxylic acid (PubChem CID 175872630) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is 7-hexyl-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-4-carboxylic acid.
| Compound Name | 7-hexyl-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-4-carboxylic acid |
|---|---|
| PubChem CID | 175872630 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 7-hexyl-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-4-carboxylic acid |
| SMILES | CCCCCCC1CCCc2c([nH]c3c(C(=O)O)cccc23)C1 |
| InChI | InChI=1S/C20H27NO2/c1-2-3-4-5-8-14-9-6-10-15-16-11-7-12-17(20(22)23)19(16)21-18(15)13-14/h7,11-12,14,21H,2-6,8-10,13H2,1H3,(H,22,23) |
| InChIKey | XOBOLSLXWNBMRS-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|