C27H32N2O4 — CID 162532239
5-[(6-carboxy-2-pyridinyl)methyl]-7-hexyl-7,8,9,10-tetrahydro-6H-cyclohepta[b]indole-4-carboxylic acid (PubChem CID 162532239) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is 5-[(6-carboxy-2-pyridinyl)methyl]-7-hexyl-7,8,9,10-tetrahydro-6H-cyclohepta[b]indole-4-carboxylic acid.
| Compound Name | 5-[(6-carboxy-2-pyridinyl)methyl]-7-hexyl-7,8,9,10-tetrahydro-6H-cyclohepta[b]indole-4-carboxylic acid |
|---|---|
| PubChem CID | 162532239 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 5-[(6-carboxy-2-pyridinyl)methyl]-7-hexyl-7,8,9,10-tetrahydro-6H-cyclohepta[b]indole-4-carboxylic acid |
| SMILES | CCCCCCC1CCCc2c(n(Cc3cccc(C(=O)O)n3)c3c(C(=O)O)cccc23)C1 |
| InChI | InChI=1S/C27H32N2O4/c1-2-3-4-5-9-18-10-6-12-20-21-13-8-14-22(26(30)31)25(21)29(24(20)16-18)17-19-11-7-15-23(28-19)27(32)33/h7-8,11,13-15,18H,2-6,9-10,12,16-17H2,1H3,(H,30,31)(H,32,33) |
| InChIKey | MQGBKWNFGYDGEI-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|