C19H25NO3 — CID 83946794
6-tert-butyl-9-(2-hydroxyethyl)-5,6,7,8-tetrahydrocarbazole-1-carboxylic acid (PubChem CID 83946794) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is 6-tert-butyl-9-(2-hydroxyethyl)-5,6,7,8-tetrahydrocarbazole-1-carboxylic acid.
| Compound Name | 6-tert-butyl-9-(2-hydroxyethyl)-5,6,7,8-tetrahydrocarbazole-1-carboxylic acid |
|---|---|
| PubChem CID | 83946794 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 6-tert-butyl-9-(2-hydroxyethyl)-5,6,7,8-tetrahydrocarbazole-1-carboxylic acid |
| SMILES | CC(C)(C)C1CCc2c(c3cccc(C(=O)O)c3n2CCO)C1 |
| InChI | InChI=1S/C19H25NO3/c1-19(2,3)12-7-8-16-15(11-12)13-5-4-6-14(18(22)23)17(13)20(16)9-10-21/h4-6,12,21H,7-11H2,1-3H3,(H,22,23) |
| InChIKey | JENZXBIHDNDJLW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|