C19H25NO2 — CID 175402071
7-hexyl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxylic acid (PubChem CID 175402071) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is 7-hexyl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxylic acid.
| Compound Name | 7-hexyl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxylic acid |
|---|---|
| PubChem CID | 175402071 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | 7-hexyl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxylic acid |
| SMILES | CCCCCCC1CCc2c([nH]c3c(C(=O)O)cccc23)C1 |
| InChI | InChI=1S/C19H25NO2/c1-2-3-4-5-7-13-10-11-14-15-8-6-9-16(19(21)22)18(15)20-17(14)12-13/h6,8-9,13,20H,2-5,7,10-12H2,1H3,(H,21,22) |
| InChIKey | PIFDBXJALVQBMR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|