C21H29N3O — CID 97023855
(6R)-6-methyl-N-(3-pyrrolidin-1-ylpropyl)-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide (PubChem CID 97023855) has the molecular formula C21H29N3O and a molecular weight of 339.48 g/mol. Its IUPAC name is (6R)-6-methyl-N-(3-pyrrolidin-1-ylpropyl)-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide.
| Compound Name | (6R)-6-methyl-N-(3-pyrrolidin-1-ylpropyl)-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 97023855 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | (6R)-6-methyl-N-(3-pyrrolidin-1-ylpropyl)-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
| SMILES | C[C@@H]1CCc2[nH]c3c(C(=O)NCCCN4CCCC4)cccc3c2C1 |
| InChI | InChI=1S/C21H29N3O/c1-15-8-9-19-18(14-15)16-6-4-7-17(20(16)23-19)21(25)22-10-5-13-24-11-2-3-12-24/h4,6-7,15,23H,2-3,5,8-14H2,1H3,(H,22,25)/t15-/m1/s1 |
| InChIKey | WPVVWDQMAMJDTP-OAHLLOKOSA-N |
| XLogP | 3.51 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|