C23H26N2O3S — CID 52535773
(6R)-6-methyl-N-[[4-(methylsulfonylmethyl)phenyl]methyl]-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide (PubChem CID 52535773) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is (6R)-6-methyl-N-[[4-(methylsulfonylmethyl)phenyl]methyl]-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide.
| Compound Name | (6R)-6-methyl-N-[[4-(methylsulfonylmethyl)phenyl]methyl]-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 52535773 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | (6R)-6-methyl-N-[[4-(methylsulfonylmethyl)phenyl]methyl]-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
| SMILES | C[C@@H]1CCc2[nH]c3c(C(=O)NCc4ccc(CS(C)(=O)=O)cc4)cccc3c2C1 |
| InChI | InChI=1S/C23H26N2O3S/c1-15-6-11-21-20(12-15)18-4-3-5-19(22(18)25-21)23(26)24-13-16-7-9-17(10-8-16)14-29(2,27)28/h3-5,7-10,15,25H,6,11-14H2,1-2H3,(H,24,26)/t15-/m1/s1 |
| InChIKey | ZHAPIOGMKLDGNP-OAHLLOKOSA-N |
| XLogP | 3.77 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|