C20H24N4O — CID 94185005
(6S)-N-(3-imidazol-1-ylpropyl)-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide (PubChem CID 94185005) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is (6S)-N-(3-imidazol-1-ylpropyl)-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide.
| Compound Name | (6S)-N-(3-imidazol-1-ylpropyl)-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 94185005 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | (6S)-N-(3-imidazol-1-ylpropyl)-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
| SMILES | C[C@H]1CCc2[nH]c3c(C(=O)NCCCn4ccnc4)cccc3c2C1 |
| InChI | InChI=1S/C20H24N4O/c1-14-6-7-18-17(12-14)15-4-2-5-16(19(15)23-18)20(25)22-8-3-10-24-11-9-21-13-24/h2,4-5,9,11,13-14,23H,3,6-8,10,12H2,1H3,(H,22,25)/t14-/m0/s1 |
| InChIKey | RKXCVYMOPIBSMC-AWEZNQCLSA-N |
| XLogP | 3.31 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|