C19H19N3O — CID 46437559
6-methyl-N-pyridin-3-yl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide (PubChem CID 46437559) has the molecular formula C19H19N3O and a molecular weight of 305.38 g/mol. Its IUPAC name is 6-methyl-N-pyridin-3-yl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide.
| Compound Name | 6-methyl-N-pyridin-3-yl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 46437559 |
| Molecular Formula | C19H19N3O |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 6-methyl-N-pyridin-3-yl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
| SMILES | CC1CCc2[nH]c3c(C(=O)Nc4cccnc4)cccc3c2C1 |
| InChI | InChI=1S/C19H19N3O/c1-12-7-8-17-16(10-12)14-5-2-6-15(18(14)22-17)19(23)21-13-4-3-9-20-11-13/h2-6,9,11-12,22H,7-8,10H2,1H3,(H,21,23) |
| InChIKey | MKGHQAGKYJTBHM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|