C24H27N3O4 — CID 60518250
N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methyl]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide (PubChem CID 60518250) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methyl]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide.
| Compound Name | N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methyl]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 60518250 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | N-[[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methyl]-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
| SMILES | COc1cc(CNC(=O)c2cccc3c4c([nH]c23)CCC(C)C4)ccc1OCC(N)=O |
| InChI | InChI=1S/C24H27N3O4/c1-14-6-8-19-18(10-14)16-4-3-5-17(23(16)27-19)24(29)26-12-15-7-9-20(21(11-15)30-2)31-13-22(25)28/h3-5,7,9,11,14,27H,6,8,10,12-13H2,1-2H3,(H2,25,28)(H,26,29) |
| InChIKey | ZOKJCMDFROHLTQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 106.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|