C20H23N3O5S — CID 9090731
2-[2-methoxy-4-[[[(5R)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]carbamoyl]phenoxy]acetamide (PubChem CID 9090731) has the molecular formula C20H23N3O5S and a molecular weight of 417.49 g/mol. Its IUPAC name is 2-[2-methoxy-4-[[[(5R)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]carbamoyl]phenoxy]acetamide.
| Compound Name | 2-[2-methoxy-4-[[[(5R)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]carbamoyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 9090731 |
| Molecular Formula | C20H23N3O5S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 2-[2-methoxy-4-[[[(5R)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]carbamoyl]phenoxy]acetamide |
| SMILES | COc1cc(C(=O)NNC(=O)c2cc3c(s2)CC[C@@H](C)C3)ccc1OCC(N)=O |
| InChI | InChI=1S/C20H23N3O5S/c1-11-3-6-16-13(7-11)9-17(29-16)20(26)23-22-19(25)12-4-5-14(15(8-12)27-2)28-10-18(21)24/h4-5,8-9,11H,3,6-7,10H2,1-2H3,(H2,21,24)(H,22,25)(H,23,26)/t11-/m1/s1 |
| InChIKey | RGZQBODXLJZJMQ-LLVKDONJSA-N |
| XLogP | 1.82 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|