C16H17N3O2S — CID 7678009
N'-[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]pyridine-4-carbohydrazide (PubChem CID 7678009) has the molecular formula C16H17N3O2S and a molecular weight of 315.40 g/mol. Its IUPAC name is N'-[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]pyridine-4-carbohydrazide.
| Compound Name | N'-[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 7678009 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | N'-[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]pyridine-4-carbohydrazide |
| SMILES | C[C@H]1CCc2sc(C(=O)NNC(=O)c3ccncc3)cc2C1 |
| InChI | InChI=1S/C16H17N3O2S/c1-10-2-3-13-12(8-10)9-14(22-13)16(21)19-18-15(20)11-4-6-17-7-5-11/h4-7,9-10H,2-3,8H2,1H3,(H,18,20)(H,19,21)/t10-/m0/s1 |
| InChIKey | LWGCJPNGMCFHAG-JTQLQIEISA-N |
| XLogP | 2.34 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|