C21H26N4O3S — CID 46437745
1-[3-[[(5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)amino]carbamoyl]phenyl]-3-propan-2-ylurea (PubChem CID 46437745) has the molecular formula C21H26N4O3S and a molecular weight of 414.53 g/mol. Its IUPAC name is 1-[3-[[(5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)amino]carbamoyl]phenyl]-3-propan-2-ylurea.
| Compound Name | 1-[3-[[(5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)amino]carbamoyl]phenyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 46437745 |
| Molecular Formula | C21H26N4O3S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 1-[3-[[(5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)amino]carbamoyl]phenyl]-3-propan-2-ylurea |
| SMILES | CC1CCc2sc(C(=O)NNC(=O)c3cccc(NC(=O)NC(C)C)c3)cc2C1 |
| InChI | InChI=1S/C21H26N4O3S/c1-12(2)22-21(28)23-16-6-4-5-14(10-16)19(26)24-25-20(27)18-11-15-9-13(3)7-8-17(15)29-18/h4-6,10-13H,7-9H2,1-3H3,(H,24,26)(H,25,27)(H2,22,23,28) |
| InChIKey | MMJJJOFLEBTYNC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|