C17H19N3O2S — CID 27516597
1-[[(6R)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]-3-phenylurea (PubChem CID 27516597) has the molecular formula C17H19N3O2S and a molecular weight of 329.42 g/mol. Its IUPAC name is 1-[[(6R)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]-3-phenylurea.
| Compound Name | 1-[[(6R)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]-3-phenylurea |
|---|---|
| PubChem CID | 27516597 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 1-[[(6R)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]-3-phenylurea |
| SMILES | C[C@@H]1CCc2cc(C(=O)NNC(=O)Nc3ccccc3)sc2C1 |
| InChI | InChI=1S/C17H19N3O2S/c1-11-7-8-12-10-15(23-14(12)9-11)16(21)19-20-17(22)18-13-5-3-2-4-6-13/h2-6,10-11H,7-9H2,1H3,(H,19,21)(H2,18,20,22)/t11-/m1/s1 |
| InChIKey | VFUQRAZUICZYDA-LLVKDONJSA-N |
| XLogP | 3.34 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|