C17H18FN3OS2 — CID 9278230
1-(2-fluorophenyl)-3-[[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]thiourea (PubChem CID 9278230) has the molecular formula C17H18FN3OS2 and a molecular weight of 363.48 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]thiourea.
| Compound Name | 1-(2-fluorophenyl)-3-[[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]thiourea |
|---|---|
| PubChem CID | 9278230 |
| Molecular Formula | C17H18FN3OS2 |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]thiourea |
| SMILES | C[C@H]1CCc2sc(C(=O)NNC(=S)Nc3ccccc3F)cc2C1 |
| InChI | InChI=1S/C17H18FN3OS2/c1-10-6-7-14-11(8-10)9-15(24-14)16(22)20-21-17(23)19-13-5-3-2-4-12(13)18/h2-5,9-10H,6-8H2,1H3,(H,20,22)(H2,19,21,23)/t10-/m0/s1 |
| InChIKey | CKAFMFILNSONQC-JTQLQIEISA-N |
| XLogP | 3.64 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|