C17H25N3OS2 — CID 7945400
1-cyclohexyl-3-[[(5R)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]thiourea (PubChem CID 7945400) has the molecular formula C17H25N3OS2 and a molecular weight of 351.54 g/mol. Its IUPAC name is 1-cyclohexyl-3-[[(5R)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]thiourea.
| Compound Name | 1-cyclohexyl-3-[[(5R)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]thiourea |
|---|---|
| PubChem CID | 7945400 |
| Molecular Formula | C17H25N3OS2 |
| Molecular Weight | 351.54 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 1-cyclohexyl-3-[[(5R)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]thiourea |
| SMILES | C[C@@H]1CCc2sc(C(=O)NNC(=S)NC3CCCCC3)cc2C1 |
| InChI | InChI=1S/C17H25N3OS2/c1-11-7-8-14-12(9-11)10-15(23-14)16(21)19-20-17(22)18-13-5-3-2-4-6-13/h10-11,13H,2-9H2,1H3,(H,19,21)(H2,18,20,22)/t11-/m1/s1 |
| InChIKey | XEPVTYJHFMFVSE-LLVKDONJSA-N |
| XLogP | 3.31 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.54 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|