C15H23N3OS3 — CID 8791053
1-(3-methylsulfanylpropyl)-3-[[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]thiourea (PubChem CID 8791053) has the molecular formula C15H23N3OS3 and a molecular weight of 357.57 g/mol. Its IUPAC name is 1-(3-methylsulfanylpropyl)-3-[[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]thiourea.
| Compound Name | 1-(3-methylsulfanylpropyl)-3-[[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]thiourea |
|---|---|
| PubChem CID | 8791053 |
| Molecular Formula | C15H23N3OS3 |
| Molecular Weight | 357.57 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 1-(3-methylsulfanylpropyl)-3-[[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]thiourea |
| SMILES | CSCCCNC(=S)NNC(=O)c1cc2c(s1)CC[C@H](C)C2 |
| InChI | InChI=1S/C15H23N3OS3/c1-10-4-5-12-11(8-10)9-13(22-12)14(19)17-18-15(20)16-6-3-7-21-2/h9-10H,3-8H2,1-2H3,(H,17,19)(H2,16,18,20)/t10-/m0/s1 |
| InChIKey | NDWHBKMPKCBSGH-JTQLQIEISA-N |
| XLogP | 2.73 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.57 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|