C16H25N3OS2 — CID 9187681
1-[[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]-3-pentylthiourea (PubChem CID 9187681) has the molecular formula C16H25N3OS2 and a molecular weight of 339.53 g/mol. Its IUPAC name is 1-[[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]-3-pentylthiourea.
| Compound Name | 1-[[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]-3-pentylthiourea |
|---|---|
| PubChem CID | 9187681 |
| Molecular Formula | C16H25N3OS2 |
| Molecular Weight | 339.53 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 1-[[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]-3-pentylthiourea |
| SMILES | CCCCCNC(=S)NNC(=O)c1cc2c(s1)CC[C@H](C)C2 |
| InChI | InChI=1S/C16H25N3OS2/c1-3-4-5-8-17-16(21)19-18-15(20)14-10-12-9-11(2)6-7-13(12)22-14/h10-11H,3-9H2,1-2H3,(H,18,20)(H2,17,19,21)/t11-/m0/s1 |
| InChIKey | LPKBTTSKLLLTGW-NSHDSACASA-N |
| XLogP | 3.17 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.53 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|