C16H25N3OS3 — CID 8790769
1-[[(5R)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]-3-(3-methylsulfanylpropyl)thiourea (PubChem CID 8790769) has the molecular formula C16H25N3OS3 and a molecular weight of 371.60 g/mol. Its IUPAC name is 1-[[(5R)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]-3-(3-methylsulfanylpropyl)thiourea.
| Compound Name | 1-[[(5R)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]-3-(3-methylsulfanylpropyl)thiourea |
|---|---|
| PubChem CID | 8790769 |
| Molecular Formula | C16H25N3OS3 |
| Molecular Weight | 371.60 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 1-[[(5R)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]-3-(3-methylsulfanylpropyl)thiourea |
| SMILES | CC[C@@H]1CCc2sc(C(=O)NNC(=S)NCCCSC)cc2C1 |
| InChI | InChI=1S/C16H25N3OS3/c1-3-11-5-6-13-12(9-11)10-14(23-13)15(20)18-19-16(21)17-7-4-8-22-2/h10-11H,3-9H2,1-2H3,(H,18,20)(H2,17,19,21)/t11-/m1/s1 |
| InChIKey | ZWHJNSSKPKNTPO-LLVKDONJSA-N |
| XLogP | 3.12 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.60 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|