C17H26N4O3S — CID 42910370
[1-[2-(5-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]urea (PubChem CID 42910370) has the molecular formula C17H26N4O3S and a molecular weight of 366.49 g/mol. Its IUPAC name is [1-[2-(5-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]urea.
| Compound Name | [1-[2-(5-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]urea |
|---|---|
| PubChem CID | 42910370 |
| Molecular Formula | C17H26N4O3S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | [1-[2-(5-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]urea |
| SMILES | CCC1CCc2sc(C(=O)NNC(=O)C(NC(N)=O)C(C)C)cc2C1 |
| InChI | InChI=1S/C17H26N4O3S/c1-4-10-5-6-12-11(7-10)8-13(25-12)15(22)20-21-16(23)14(9(2)3)19-17(18)24/h8-10,14H,4-7H2,1-3H3,(H,20,22)(H,21,23)(H3,18,19,24) |
| InChIKey | NRNHVBMWJQMMHO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|