C17H25N3O2S2 — CID 9101613
1-[[(5S)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]-3-[[(2R)-oxolan-2-yl]methyl]thiourea (PubChem CID 9101613) has the molecular formula C17H25N3O2S2 and a molecular weight of 367.54 g/mol. Its IUPAC name is 1-[[(5S)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]-3-[[(2R)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[[(5S)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 9101613 |
| Molecular Formula | C17H25N3O2S2 |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 1-[[(5S)-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
| SMILES | CC[C@H]1CCc2sc(C(=O)NNC(=S)NC[C@H]3CCCO3)cc2C1 |
| InChI | InChI=1S/C17H25N3O2S2/c1-2-11-5-6-14-12(8-11)9-15(24-14)16(21)19-20-17(23)18-10-13-4-3-7-22-13/h9,11,13H,2-8,10H2,1H3,(H,19,21)(H2,18,20,23)/t11-,13+/m0/s1 |
| InChIKey | VLXIWWWCXHZMOL-WCQYABFASA-N |
| XLogP | 2.55 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|