C14H19N3O4S2 — CID 47005571
1-[(3-methylsulfonylbenzoyl)amino]-3-(oxolan-2-ylmethyl)thiourea (PubChem CID 47005571) has the molecular formula C14H19N3O4S2 and a molecular weight of 357.46 g/mol. Its IUPAC name is 1-[(3-methylsulfonylbenzoyl)amino]-3-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-[(3-methylsulfonylbenzoyl)amino]-3-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 47005571 |
| Molecular Formula | C14H19N3O4S2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 1-[(3-methylsulfonylbenzoyl)amino]-3-(oxolan-2-ylmethyl)thiourea |
| SMILES | CS(=O)(=O)c1cccc(C(=O)NNC(=S)NCC2CCCO2)c1 |
| InChI | InChI=1S/C14H19N3O4S2/c1-23(19,20)12-6-2-4-10(8-12)13(18)16-17-14(22)15-9-11-5-3-7-21-11/h2,4,6,8,11H,3,5,7,9H2,1H3,(H,16,18)(H2,15,17,22) |
| InChIKey | QIIJEFZNZVGIRV-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|