C21H26N4O4S2 — CID 41144560
1-[[4-methyl-3-[(3-methylphenyl)sulfamoyl]benzoyl]amino]-3-[[(2R)-oxolan-2-yl]methyl]thiourea (PubChem CID 41144560) has the molecular formula C21H26N4O4S2 and a molecular weight of 462.60 g/mol. Its IUPAC name is 1-[[4-methyl-3-[(3-methylphenyl)sulfamoyl]benzoyl]amino]-3-[[(2R)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[[4-methyl-3-[(3-methylphenyl)sulfamoyl]benzoyl]amino]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 41144560 |
| Molecular Formula | C21H26N4O4S2 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 1-[[4-methyl-3-[(3-methylphenyl)sulfamoyl]benzoyl]amino]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
| SMILES | Cc1cccc(NS(=O)(=O)c2cc(C(=O)NNC(=S)NC[C@H]3CCCO3)ccc2C)c1 |
| InChI | InChI=1S/C21H26N4O4S2/c1-14-5-3-6-17(11-14)25-31(27,28)19-12-16(9-8-15(19)2)20(26)23-24-21(30)22-13-18-7-4-10-29-18/h3,5-6,8-9,11-12,18,25H,4,7,10,13H2,1-2H3,(H,23,26)(H2,22,24,30)/t18-/m1/s1 |
| InChIKey | ZHWGZLFDSSQYFN-GOSISDBHSA-N |
| XLogP | 2.39 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|