C21H26N2O4S — CID 2977769
3-[(2,4-dimethylphenyl)sulfamoyl]-4-methyl-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 2977769) has the molecular formula C21H26N2O4S and a molecular weight of 402.52 g/mol. Its IUPAC name is 3-[(2,4-dimethylphenyl)sulfamoyl]-4-methyl-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 3-[(2,4-dimethylphenyl)sulfamoyl]-4-methyl-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 2977769 |
| Molecular Formula | C21H26N2O4S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 3-[(2,4-dimethylphenyl)sulfamoyl]-4-methyl-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cc(C(=O)NCC3CCCO3)ccc2C)c(C)c1 |
| InChI | InChI=1S/C21H26N2O4S/c1-14-6-9-19(16(3)11-14)23-28(25,26)20-12-17(8-7-15(20)2)21(24)22-13-18-5-4-10-27-18/h6-9,11-12,18,23H,4-5,10,13H2,1-3H3,(H,22,24) |
| InChIKey | MAPOGOLQXXVNAF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |