C21H25BrN4O5S2 — CID 98396251
1-[[4-[(5-bromo-2-ethoxyphenyl)sulfonylamino]benzoyl]amino]-3-[[(2S)-oxolan-2-yl]methyl]thiourea (PubChem CID 98396251) has the molecular formula C21H25BrN4O5S2 and a molecular weight of 557.49 g/mol. Its IUPAC name is 1-[[4-[(5-bromo-2-ethoxyphenyl)sulfonylamino]benzoyl]amino]-3-[[(2S)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[[4-[(5-bromo-2-ethoxyphenyl)sulfonylamino]benzoyl]amino]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 98396251 |
| Molecular Formula | C21H25BrN4O5S2 |
| Molecular Weight | 557.49 g/mol |
| Exact Mass | 556.04 |
| IUPAC Name | 1-[[4-[(5-bromo-2-ethoxyphenyl)sulfonylamino]benzoyl]amino]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
| SMILES | CCOc1ccc(Br)cc1S(=O)(=O)Nc1ccc(C(=O)NNC(=S)NC[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C21H25BrN4O5S2/c1-2-30-18-10-7-15(22)12-19(18)33(28,29)26-16-8-5-14(6-9-16)20(27)24-25-21(32)23-13-17-4-3-11-31-17/h5-10,12,17,26H,2-4,11,13H2,1H3,(H,24,27)(H2,23,25,32)/t17-/m0/s1 |
| InChIKey | BJDSVTJAKQXDLJ-KRWDZBQOSA-N |
| XLogP | 2.94 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|