C18H27N3O4S — CID 1172906
N-[2,5-diethoxy-4-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]phenyl]acetamide (PubChem CID 1172906) has the molecular formula C18H27N3O4S and a molecular weight of 381.50 g/mol. Its IUPAC name is N-[2,5-diethoxy-4-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]phenyl]acetamide.
| Compound Name | N-[2,5-diethoxy-4-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 1172906 |
| Molecular Formula | C18H27N3O4S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | N-[2,5-diethoxy-4-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]phenyl]acetamide |
| SMILES | CCOc1cc(NC(=S)NC[C@H]2CCCO2)c(OCC)cc1NC(C)=O |
| InChI | InChI=1S/C18H27N3O4S/c1-4-23-16-10-15(17(24-5-2)9-14(16)20-12(3)22)21-18(26)19-11-13-7-6-8-25-13/h9-10,13H,4-8,11H2,1-3H3,(H,20,22)(H2,19,21,26)/t13-/m1/s1 |
| InChIKey | CDFZZXAUMLSEOW-CYBMUJFWSA-N |
| XLogP | 2.91 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|