C23H28ClN3O4S — CID 5174587
2-chloro-N-[2,5-diethoxy-4-(oxolan-2-ylmethylcarbamothioylamino)phenyl]benzamide (PubChem CID 5174587) has the molecular formula C23H28ClN3O4S and a molecular weight of 478.01 g/mol. Its IUPAC name is 2-chloro-N-[2,5-diethoxy-4-(oxolan-2-ylmethylcarbamothioylamino)phenyl]benzamide.
| Compound Name | 2-chloro-N-[2,5-diethoxy-4-(oxolan-2-ylmethylcarbamothioylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 5174587 |
| Molecular Formula | C23H28ClN3O4S |
| Molecular Weight | 478.01 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 2-chloro-N-[2,5-diethoxy-4-(oxolan-2-ylmethylcarbamothioylamino)phenyl]benzamide |
| SMILES | CCOc1cc(NC(=S)NCC2CCCO2)c(OCC)cc1NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C23H28ClN3O4S/c1-3-29-20-13-19(27-23(32)25-14-15-8-7-11-31-15)21(30-4-2)12-18(20)26-22(28)16-9-5-6-10-17(16)24/h5-6,9-10,12-13,15H,3-4,7-8,11,14H2,1-2H3,(H,26,28)(H2,25,27,32) |
| InChIKey | WVACEBXINUJEAD-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.01 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|