C21H33N3O4S — CID 7120300
N-[2,5-diethoxy-4-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]phenyl]-3-methylbutanamide (PubChem CID 7120300) has the molecular formula C21H33N3O4S and a molecular weight of 423.58 g/mol. Its IUPAC name is N-[2,5-diethoxy-4-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]phenyl]-3-methylbutanamide.
| Compound Name | N-[2,5-diethoxy-4-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 7120300 |
| Molecular Formula | C21H33N3O4S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | N-[2,5-diethoxy-4-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]phenyl]-3-methylbutanamide |
| SMILES | CCOc1cc(NC(=S)NC[C@H]2CCCO2)c(OCC)cc1NC(=O)CC(C)C |
| InChI | InChI=1S/C21H33N3O4S/c1-5-26-18-12-17(24-21(29)22-13-15-8-7-9-28-15)19(27-6-2)11-16(18)23-20(25)10-14(3)4/h11-12,14-15H,5-10,13H2,1-4H3,(H,23,25)(H2,22,24,29)/t15-/m1/s1 |
| InChIKey | YRFVEONRPKUAIU-OAHLLOKOSA-N |
| XLogP | 3.93 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|