C19H29N3O5S — CID 27000622
1-[[(2S)-oxolan-2-yl]methyl]-3-[(3,4,5-triethoxybenzoyl)amino]thiourea (PubChem CID 27000622) has the molecular formula C19H29N3O5S and a molecular weight of 411.52 g/mol. Its IUPAC name is 1-[[(2S)-oxolan-2-yl]methyl]-3-[(3,4,5-triethoxybenzoyl)amino]thiourea.
| Compound Name | 1-[[(2S)-oxolan-2-yl]methyl]-3-[(3,4,5-triethoxybenzoyl)amino]thiourea |
|---|---|
| PubChem CID | 27000622 |
| Molecular Formula | C19H29N3O5S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 1-[[(2S)-oxolan-2-yl]methyl]-3-[(3,4,5-triethoxybenzoyl)amino]thiourea |
| SMILES | CCOc1cc(C(=O)NNC(=S)NC[C@@H]2CCCO2)cc(OCC)c1OCC |
| InChI | InChI=1S/C19H29N3O5S/c1-4-24-15-10-13(11-16(25-5-2)17(15)26-6-3)18(23)21-22-19(28)20-12-14-8-7-9-27-14/h10-11,14H,4-9,12H2,1-3H3,(H,21,23)(H2,20,22,28)/t14-/m0/s1 |
| InChIKey | IKGYRNQWRLNRIN-AWEZNQCLSA-N |
| XLogP | 2.17 |
| TPSA | 90.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|