C16H21BrN2O4S — CID 17357529
5-bromo-2-(2-methoxyethoxy)-N-(oxolan-2-ylmethylcarbamothioyl)benzamide (PubChem CID 17357529) has the molecular formula C16H21BrN2O4S and a molecular weight of 417.33 g/mol. Its IUPAC name is 5-bromo-2-(2-methoxyethoxy)-N-(oxolan-2-ylmethylcarbamothioyl)benzamide.
| Compound Name | 5-bromo-2-(2-methoxyethoxy)-N-(oxolan-2-ylmethylcarbamothioyl)benzamide |
|---|---|
| PubChem CID | 17357529 |
| Molecular Formula | C16H21BrN2O4S |
| Molecular Weight | 417.33 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | 5-bromo-2-(2-methoxyethoxy)-N-(oxolan-2-ylmethylcarbamothioyl)benzamide |
| SMILES | COCCOc1ccc(Br)cc1C(=O)NC(=S)NCC1CCCO1 |
| InChI | InChI=1S/C16H21BrN2O4S/c1-21-7-8-23-14-5-4-11(17)9-13(14)15(20)19-16(24)18-10-12-3-2-6-22-12/h4-5,9,12H,2-3,6-8,10H2,1H3,(H2,18,19,20,24) |
| InChIKey | PLOAEUNKGMNZOD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|