C22H25BrN2O4S — CID 17352140
5-bromo-N-[[4-(oxolan-2-ylmethoxy)phenyl]carbamothioyl]-2-propoxybenzamide (PubChem CID 17352140) has the molecular formula C22H25BrN2O4S and a molecular weight of 493.42 g/mol. Its IUPAC name is 5-bromo-N-[[4-(oxolan-2-ylmethoxy)phenyl]carbamothioyl]-2-propoxybenzamide.
| Compound Name | 5-bromo-N-[[4-(oxolan-2-ylmethoxy)phenyl]carbamothioyl]-2-propoxybenzamide |
|---|---|
| PubChem CID | 17352140 |
| Molecular Formula | C22H25BrN2O4S |
| Molecular Weight | 493.42 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | 5-bromo-N-[[4-(oxolan-2-ylmethoxy)phenyl]carbamothioyl]-2-propoxybenzamide |
| SMILES | CCCOc1ccc(Br)cc1C(=O)NC(=S)Nc1ccc(OCC2CCCO2)cc1 |
| InChI | InChI=1S/C22H25BrN2O4S/c1-2-11-28-20-10-5-15(23)13-19(20)21(26)25-22(30)24-16-6-8-17(9-7-16)29-14-18-4-3-12-27-18/h5-10,13,18H,2-4,11-12,14H2,1H3,(H2,24,25,26,30) |
| InChIKey | JCQNXWQIMIUYDP-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.42 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|