C24H32N4O4S2 — CID 4676675
1-[[4-[(5-tert-butyl-2-methylphenyl)sulfonylamino]benzoyl]amino]-3-(oxolan-2-ylmethyl)thiourea (PubChem CID 4676675) has the molecular formula C24H32N4O4S2 and a molecular weight of 504.68 g/mol. Its IUPAC name is 1-[[4-[(5-tert-butyl-2-methylphenyl)sulfonylamino]benzoyl]amino]-3-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-[[4-[(5-tert-butyl-2-methylphenyl)sulfonylamino]benzoyl]amino]-3-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4676675 |
| Molecular Formula | C24H32N4O4S2 |
| Molecular Weight | 504.68 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | 1-[[4-[(5-tert-butyl-2-methylphenyl)sulfonylamino]benzoyl]amino]-3-(oxolan-2-ylmethyl)thiourea |
| SMILES | Cc1ccc(C(C)(C)C)cc1S(=O)(=O)Nc1ccc(C(=O)NNC(=S)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C24H32N4O4S2/c1-16-7-10-18(24(2,3)4)14-21(16)34(30,31)28-19-11-8-17(9-12-19)22(29)26-27-23(33)25-15-20-6-5-13-32-20/h7-12,14,20,28H,5-6,13,15H2,1-4H3,(H,26,29)(H2,25,27,33) |
| InChIKey | FOIFSHLZTUWQDA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.68 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|