C17H24N4O3S — CID 9090734
(3R)-3-[[[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]carbamoyl]piperidine-1-carboxamide (PubChem CID 9090734) has the molecular formula C17H24N4O3S and a molecular weight of 364.47 g/mol. Its IUPAC name is (3R)-3-[[[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]carbamoyl]piperidine-1-carboxamide.
| Compound Name | (3R)-3-[[[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]carbamoyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 9090734 |
| Molecular Formula | C17H24N4O3S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | (3R)-3-[[[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]amino]carbamoyl]piperidine-1-carboxamide |
| SMILES | C[C@H]1CCc2sc(C(=O)NNC(=O)[C@@H]3CCCN(C(N)=O)C3)cc2C1 |
| InChI | InChI=1S/C17H24N4O3S/c1-10-4-5-13-12(7-10)8-14(25-13)16(23)20-19-15(22)11-3-2-6-21(9-11)17(18)24/h8,10-11H,2-7,9H2,1H3,(H2,18,24)(H,19,22)(H,20,23)/t10-,11+/m0/s1 |
| InChIKey | IHWXNBIIZJGMEQ-WDEREUQCSA-N |
| XLogP | 1.42 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|