C15H20N2O3S — CID 46465209
N'-(5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)oxolane-2-carbohydrazide (PubChem CID 46465209) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is N'-(5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)oxolane-2-carbohydrazide.
| Compound Name | N'-(5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)oxolane-2-carbohydrazide |
|---|---|
| PubChem CID | 46465209 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | N'-(5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)oxolane-2-carbohydrazide |
| SMILES | CC1CCc2sc(C(=O)NNC(=O)C3CCCO3)cc2C1 |
| InChI | InChI=1S/C15H20N2O3S/c1-9-4-5-12-10(7-9)8-13(21-12)15(19)17-16-14(18)11-3-2-6-20-11/h8-9,11H,2-7H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | VTXMYYGQCZDQIQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|